C12H14F9NO — CID 58602100
N-methyl-N-(4,4,5,5,6,6,7,7,7-nonafluoro-3-methylheptyl)prop-2-enamide (PubChem CID 58602100) has the molecular formula C12H14F9NO and a molecular weight of 359.23 g/mol. Its IUPAC name is N-methyl-N-(4,4,5,5,6,6,7,7,7-nonafluoro-3-methylheptyl)prop-2-enamide.
| Compound Name | N-methyl-N-(4,4,5,5,6,6,7,7,7-nonafluoro-3-methylheptyl)prop-2-enamide |
|---|---|
| PubChem CID | 58602100 |
| Molecular Formula | C12H14F9NO |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-methyl-N-(4,4,5,5,6,6,7,7,7-nonafluoro-3-methylheptyl)prop-2-enamide |
| SMILES | C=CC(=O)N(C)CCC(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H14F9NO/c1-4-8(23)22(3)6-5-7(2)9(13,14)10(15,16)11(17,18)12(19,20)21/h4,7H,1,5-6H2,2-3H3 |
| InChIKey | BMEDBPHWQZAEOH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|