C5H5F7O2 — CID 58602209
1-(1,1-difluoroethoxy)-1,1,2,2-tetrafluoro-2-(fluoromethoxy)ethane (PubChem CID 58602209) has the molecular formula C5H5F7O2 and a molecular weight of 230.08 g/mol. Its IUPAC name is 1-(1,1-difluoroethoxy)-1,1,2,2-tetrafluoro-2-(fluoromethoxy)ethane.
| Compound Name | 1-(1,1-difluoroethoxy)-1,1,2,2-tetrafluoro-2-(fluoromethoxy)ethane |
|---|---|
| PubChem CID | 58602209 |
| Molecular Formula | C5H5F7O2 |
| Molecular Weight | 230.08 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 1-(1,1-difluoroethoxy)-1,1,2,2-tetrafluoro-2-(fluoromethoxy)ethane |
| SMILES | CC(F)(F)OC(F)(F)C(F)(F)OCF |
| InChI | InChI=1S/C5H5F7O2/c1-3(7,8)14-5(11,12)4(9,10)13-2-6/h2H2,1H3 |
| InChIKey | IUEDAVSCFBEZPM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.08 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|