C10H10BrCl2NO — CID 58602689
3-bromo-6,8-dichloro-1,2,4,5-tetrahydro-3-benzazepin-7-ol (PubChem CID 58602689) has the molecular formula C10H10BrCl2NO and a molecular weight of 311.01 g/mol. Its IUPAC name is 3-bromo-6,8-dichloro-1,2,4,5-tetrahydro-3-benzazepin-7-ol.
| Compound Name | 3-bromo-6,8-dichloro-1,2,4,5-tetrahydro-3-benzazepin-7-ol |
|---|---|
| PubChem CID | 58602689 |
| Molecular Formula | C10H10BrCl2NO |
| Molecular Weight | 311.01 g/mol |
| Exact Mass | 308.93 |
| IUPAC Name | 3-bromo-6,8-dichloro-1,2,4,5-tetrahydro-3-benzazepin-7-ol |
| SMILES | Oc1c(Cl)cc2c(c1Cl)CCN(Br)CC2 |
| InChI | InChI=1S/C10H10BrCl2NO/c11-14-3-1-6-5-8(12)10(15)9(13)7(6)2-4-14/h5,15H,1-4H2 |
| InChIKey | BOPWLCNOLRBCLI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.01 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|