C12H23N4- — CID 58603024
2-(4-butylpiperazin-1-yl)-1,4,5,6-tetrahydropyrimidine (PubChem CID 58603024) has the molecular formula C12H23N4- and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-(4-butylpiperazin-1-yl)-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-(4-butylpiperazin-1-yl)-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 58603024 |
| Molecular Formula | C12H23N4- |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 2-(4-butylpiperazin-1-yl)-1,4,5,6-tetrahydropyrimidine |
| SMILES | [CH2-]CCCN1CCN(C2=NCCCN2)CC1 |
| InChI | InChI=1S/C12H23N4/c1-2-3-7-15-8-10-16(11-9-15)12-13-5-4-6-14-12/h1-11H2,(H,13,14)/q-1 |
| InChIKey | WROUBWBFLFVWNM-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|