C8H9N5O — CID 58603083
2-amino-8-prop-2-enylimidazo[1,2-a][1,3,5]triazin-4-one (PubChem CID 58603083) has the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-amino-8-prop-2-enylimidazo[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 2-amino-8-prop-2-enylimidazo[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 58603083 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 2-amino-8-prop-2-enylimidazo[1,2-a][1,3,5]triazin-4-one |
| SMILES | C=CCn1ccn2c(=O)nc(N)nc12 |
| InChI | InChI=1S/C8H9N5O/c1-2-3-12-4-5-13-7(12)10-6(9)11-8(13)14/h2,4-5H,1,3H2,(H2,9,11,14) |
| InChIKey | DMDPJHRCLQFJMS-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|