C12H17BrFNO — CID 58603321
2-(4-bromo-2-fluorophenoxy)-N,N-diethylethanamine (PubChem CID 58603321) has the molecular formula C12H17BrFNO and a molecular weight of 290.18 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenoxy)-N,N-diethylethanamine.
| Compound Name | 2-(4-bromo-2-fluorophenoxy)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 58603321 |
| Molecular Formula | C12H17BrFNO |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-(4-bromo-2-fluorophenoxy)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1ccc(Br)cc1F |
| InChI | InChI=1S/C12H17BrFNO/c1-3-15(4-2)7-8-16-12-6-5-10(13)9-11(12)14/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | QDXWHXMQRNDTKQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |