C10H15NO — CID 586035
1,3,4,5,6-pentamethylpyridin-2-one (PubChem CID 586035) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 1,3,4,5,6-pentamethylpyridin-2-one.
| Compound Name | 1,3,4,5,6-pentamethylpyridin-2-one |
|---|---|
| PubChem CID | 586035 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 1,3,4,5,6-pentamethylpyridin-2-one |
| SMILES | Cc1c(C)c(C)n(C)c(=O)c1C |
| InChI | InChI=1S/C10H15NO/c1-6-7(2)9(4)11(5)10(12)8(6)3/h1-5H3 |
| InChIKey | CQLQPERCKHLKSV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |