C31H34N2 — CID 58604236
2,4,6-tris(2,3,4-trimethylphenyl)pyrimidine (PubChem CID 58604236) has the molecular formula C31H34N2 and a molecular weight of 434.63 g/mol. Its IUPAC name is 2,4,6-tris(2,3,4-trimethylphenyl)pyrimidine.
| Compound Name | 2,4,6-tris(2,3,4-trimethylphenyl)pyrimidine |
|---|---|
| PubChem CID | 58604236 |
| Molecular Formula | C31H34N2 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 2,4,6-tris(2,3,4-trimethylphenyl)pyrimidine |
| SMILES | Cc1ccc(-c2cc(-c3ccc(C)c(C)c3C)nc(-c3ccc(C)c(C)c3C)n2)c(C)c1C |
| InChI | InChI=1S/C31H34N2/c1-17-10-13-26(23(7)20(17)4)29-16-30(27-14-11-18(2)21(5)24(27)8)33-31(32-29)28-15-12-19(3)22(6)25(28)9/h10-16H,1-9H3 |
| InChIKey | NAWIPEBETQOAKX-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |