About (3R)-2,3-dimethyl-6,10-dithia-2-azaspiro[4.5]decane
(3R)-2,3-dimethyl-6,10-dithia-2-azaspiro[4.5]decane (PubChem CID 58605138) has the molecular formula C9H17NS2
and a molecular weight of 203.38 g/mol. Its IUPAC name is (3R)-2,3-dimethyl-6,10-dithia-2-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | (3R)-2,3-dimethyl-6,10-dithia-2-azaspiro[4.5]decane |
| PubChem CID | 58605138 |
| Molecular Formula | C9H17NS2 |
| Molecular Weight | 203.38 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | (3R)-2,3-dimethyl-6,10-dithia-2-azaspiro[4.5]decane |
| SMILES | C[C@@H]1CC2(CN1C)SCCCS2 |
| InChI | InChI=1S/C9H17NS2/c1-8-6-9(7-10(8)2)11-4-3-5-12-9/h8H,3-7H2,1-2H3/t8-/m1/s1 |
| InChIKey | XWVHEPIBQUJZLW-MRVPVSSYSA-N |
| XLogP | 2.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-2,3-dimethyl-6,10-dithia-2-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2,3-dimethyl-6,10-dithia-2-azaspiro[4.5]decane?
The IUPAC name of (3R)-2,3-dimethyl-6,10-dithia-2-azaspiro[4.5]decane (CID 58605138) is (3R)-2,3-dimethyl-6,10-dithia-2-azaspiro[4.5]decane.
What is the SMILES notation for (3R)-2,3-dimethyl-6,10-dithia-2-azaspiro[4.5]decane?
The canonical SMILES for (3R)-2,3-dimethyl-6,10-dithia-2-azaspiro[4.5]decane is C[C@@H]1CC2(CN1C)SCCCS2.
What is the InChIKey of (3R)-2,3-dimethyl-6,10-dithia-2-azaspiro[4.5]decane?
The InChIKey is XWVHEPIBQUJZLW-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H17NS2/c1-8-6-9(7-10(8)2)11-4-3-5-12-9/h8H,3-7H2,1-2H3/t8-/m1/s1.
What are the key properties of (3R)-2,3-dimethyl-6,10-dithia-2-azaspiro[4.5]decane?
(3R)-2,3-dimethyl-6,10-dithia-2-azaspiro[4.5]decane has a molecular weight of 203.38 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2,3-dimethyl-6,10-dithia-2-azaspiro[4.5]decane is sourced from PubChem (CID 58605138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).