C29H46N4O8 — CID 58605479
methyl 2-[[3-[[(1R,2S,5S)-3-[(2R)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxohept-6-enoyl]amino]acetate (PubChem CID 58605479) has the molecular formula C29H46N4O8 and a molecular weight of 578.71 g/mol. Its IUPAC name is methyl 2-[[3-[[(1R,2S,5S)-3-[(2R)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxohept-6-enoyl]amino]acetate.
| Compound Name | methyl 2-[[3-[[(1R,2S,5S)-3-[(2R)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxohept-6-enoyl]amino]acetate |
|---|---|
| PubChem CID | 58605479 |
| Molecular Formula | C29H46N4O8 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.33 |
| IUPAC Name | methyl 2-[[3-[[(1R,2S,5S)-3-[(2R)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxohept-6-enoyl]amino]acetate |
| SMILES | C=CCCC(NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@H](NC(=O)OC(C)(C)C)C(C)(C)C)C2(C)C)C(=O)C(=O)NCC(=O)OC |
| InChI | InChI=1S/C29H46N4O8/c1-11-12-13-17(21(35)24(37)30-14-18(34)40-10)31-23(36)20-19-16(29(19,8)9)15-33(20)25(38)22(27(2,3)4)32-26(39)41-28(5,6)7/h11,16-17,19-20,22H,1,12-15H2,2-10H3,(H,30,37)(H,31,36)(H,32,39)/t16-,17?,19-,20-,22-/m0/s1 |
| InChIKey | KPNSXFAAIWFRDP-QZYWRNGOSA-N |
| XLogP | 1.72 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|