C26H38F2N4O4 — CID 58605568
(1R,2S)-3-[2-amino-2-(4,4-difluorocyclohexyl)acetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-en-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 58605568) has the molecular formula C26H38F2N4O4 and a molecular weight of 508.61 g/mol. Its IUPAC name is (1R,2S)-3-[2-amino-2-(4,4-difluorocyclohexyl)acetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-en-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S)-3-[2-amino-2-(4,4-difluorocyclohexyl)acetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-en-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 58605568 |
| Molecular Formula | C26H38F2N4O4 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | (1R,2S)-3-[2-amino-2-(4,4-difluorocyclohexyl)acetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-en-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | C=CCCC(NC(=O)[C@@H]1[C@@H]2C(CN1C(=O)C(N)C1CCC(F)(F)CC1)C2(C)C)C(=O)C(=O)NCC=C |
| InChI | InChI=1S/C26H38F2N4O4/c1-5-7-8-17(21(33)23(35)30-13-6-2)31-22(34)20-18-16(25(18,3)4)14-32(20)24(36)19(29)15-9-11-26(27,28)12-10-15/h5-6,15-20H,1-2,7-14,29H2,3-4H3,(H,30,35)(H,31,34)/t16?,17?,18-,19?,20-/m0/s1 |
| InChIKey | RHPFVAXUALVCEG-KJPRWFPHSA-N |
| XLogP | 1.94 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|