C23H38N2O5 — CID 58606043
tert-butyl N-[(1S)-2-[(3aR,4S)-4-acetyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-5-yl]-1-cyclohexyl-2-oxoethyl]carbamate (PubChem CID 58606043) has the molecular formula C23H38N2O5 and a molecular weight of 422.57 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[(3aR,4S)-4-acetyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-5-yl]-1-cyclohexyl-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[(3aR,4S)-4-acetyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-5-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 58606043 |
| Molecular Formula | C23H38N2O5 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | tert-butyl N-[(1S)-2-[(3aR,4S)-4-acetyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-5-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
| SMILES | CC(=O)[C@@H]1[C@H]2CC(C)(C)OC2CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C23H38N2O5/c1-14(26)19-16-12-23(5,6)29-17(16)13-25(19)20(27)18(15-10-8-7-9-11-15)24-21(28)30-22(2,3)4/h15-19H,7-13H2,1-6H3,(H,24,28)/t16-,17?,18-,19+/m0/s1 |
| InChIKey | YJCBXRHKOGPVOC-QBUWPKIASA-N |
| XLogP | 3.44 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |