C15H25ClFNO3 — CID 58606456
tert-butyl (4S)-4-[(Z)-5-chloro-4-fluoropent-3-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 58606456) has the molecular formula C15H25ClFNO3 and a molecular weight of 321.82 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(Z)-5-chloro-4-fluoropent-3-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(Z)-5-chloro-4-fluoropent-3-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 58606456 |
| Molecular Formula | C15H25ClFNO3 |
| Molecular Weight | 321.82 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | tert-butyl (4S)-4-[(Z)-5-chloro-4-fluoropent-3-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CC/C=C(\F)CCl)COC1(C)C |
| InChI | InChI=1S/C15H25ClFNO3/c1-14(2,3)21-13(19)18-12(10-20-15(18,4)5)8-6-7-11(17)9-16/h7,12H,6,8-10H2,1-5H3/b11-7-/t12-/m0/s1 |
| InChIKey | YVPSFJDFQQGFBX-RDQDRAATSA-N |
| XLogP | 4.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.82 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|