About CID 58606544
CID 58606544 (PubChem CID 58606544) has the molecular formula C13H12F3S
and a molecular weight of 257.30 g/mol.
Molecular Properties
| Compound Name | CID 58606544 |
| PubChem CID | 58606544 |
| Molecular Formula | C13H12F3S |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | — |
| SMILES | [CH2]S(F)(F)(F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H12F3S/c1-17(14,15,16,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H2 |
| InChIKey | GRSZBNQMXJKBER-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 58606544 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58606544?
The IUPAC name of CID 58606544 (CID 58606544) is not available.
What is the SMILES notation for CID 58606544?
The canonical SMILES for CID 58606544 is [CH2]S(F)(F)(F)(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 58606544?
The InChIKey is GRSZBNQMXJKBER-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3S/c1-17(14,15,16,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H2.
What are the key properties of CID 58606544?
CID 58606544 has a molecular weight of 257.30 g/mol, XLogP of 5.43, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58606544 is sourced from PubChem (CID 58606544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).