C50H30F12 — CID 58607551
2,8-dimethyl-6,6,12,12-tetrakis[4-(trifluoromethyl)phenyl]indeno[1,2-b]fluorene (PubChem CID 58607551) has the molecular formula C50H30F12 and a molecular weight of 858.77 g/mol. Its IUPAC name is 2,8-dimethyl-6,6,12,12-tetrakis[4-(trifluoromethyl)phenyl]indeno[1,2-b]fluorene.
| Compound Name | 2,8-dimethyl-6,6,12,12-tetrakis[4-(trifluoromethyl)phenyl]indeno[1,2-b]fluorene |
|---|---|
| PubChem CID | 58607551 |
| Molecular Formula | C50H30F12 |
| Molecular Weight | 858.77 g/mol |
| Exact Mass | 858.22 |
| IUPAC Name | 2,8-dimethyl-6,6,12,12-tetrakis[4-(trifluoromethyl)phenyl]indeno[1,2-b]fluorene |
| SMILES | Cc1ccc2c(c1)C(c1ccc(C(F)(F)F)cc1)(c1ccc(C(F)(F)F)cc1)c1cc3c(cc1-2)C(c1ccc(C(F)(F)F)cc1)(c1ccc(C(F)(F)F)cc1)c1cc(C)ccc1-3 |
| InChI | InChI=1S/C50H30F12/c1-27-3-21-37-39-25-44-40(26-43(39)45(41(37)23-27,29-5-13-33(14-6-29)47(51,52)53)30-7-15-34(16-8-30)48(54,55)56)38-22-4-28(2)24-42(38)46(44,31-9-17-35(18-10-31)49(57,58)59)32-11-19-36(20-12-32)50(60,61)62/h3-26H,1-2H3 |
| InChIKey | ZZGONMDSCFOGQB-UHFFFAOYSA-N |
| XLogP | 15.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.77 |
| LogP ≤ 5 | 15.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |