C12H20O3 — CID 58607688
(4-methyl-3-oxopent-4-enyl) 2,2-dimethylbutanoate (PubChem CID 58607688) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (4-methyl-3-oxopent-4-enyl) 2,2-dimethylbutanoate.
| Compound Name | (4-methyl-3-oxopent-4-enyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58607688 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (4-methyl-3-oxopent-4-enyl) 2,2-dimethylbutanoate |
| SMILES | C=C(C)C(=O)CCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C12H20O3/c1-6-12(4,5)11(14)15-8-7-10(13)9(2)3/h2,6-8H2,1,3-5H3 |
| InChIKey | FUWYUJXMTVAVMC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|