About CID 58607752
CID 58607752 (PubChem CID 58607752) has the molecular formula C12H17BN2O5
and a molecular weight of 280.09 g/mol.
Molecular Properties
| Compound Name | CID 58607752 |
| PubChem CID | 58607752 |
| Molecular Formula | C12H17BN2O5 |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NC(C=CC(=O)OCC)CC1OCCNC1=O |
| InChI | InChI=1S/C12H17BN2O5/c1-2-19-10(16)4-3-8(15-12(13)18)7-9-11(17)14-5-6-20-9/h3-4,8-9H,2,5-7H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | UOTJJVFJAMJIEL-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 58607752 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58607752?
The IUPAC name of CID 58607752 (CID 58607752) is not available.
What is the SMILES notation for CID 58607752?
The canonical SMILES for CID 58607752 is [B]C(=O)NC(C=CC(=O)OCC)CC1OCCNC1=O.
What is the InChIKey of CID 58607752?
The InChIKey is UOTJJVFJAMJIEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BN2O5/c1-2-19-10(16)4-3-8(15-12(13)18)7-9-11(17)14-5-6-20-9/h3-4,8-9H,2,5-7H2,1H3,(H,14,17)(H,15,18).
What are the key properties of CID 58607752?
CID 58607752 has a molecular weight of 280.09 g/mol, XLogP of -0.74, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58607752 is sourced from PubChem (CID 58607752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).