C30H25Cl2N7O5S2 — CID 58607973
2-[2-(benzo[b][1]benzazepine-11-carbonylcarbamoyloxy)ethyldisulfanyl]ethyl N-[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]carbamate (PubChem CID 58607973) has the molecular formula C30H25Cl2N7O5S2 and a molecular weight of 698.61 g/mol. Its IUPAC name is 2-[2-(benzo[b][1]benzazepine-11-carbonylcarbamoyloxy)ethyldisulfanyl]ethyl N-[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]carbamate.
| Compound Name | 2-[2-(benzo[b][1]benzazepine-11-carbonylcarbamoyloxy)ethyldisulfanyl]ethyl N-[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]carbamate |
|---|---|
| PubChem CID | 58607973 |
| Molecular Formula | C30H25Cl2N7O5S2 |
| Molecular Weight | 698.61 g/mol |
| Exact Mass | 697.07 |
| IUPAC Name | 2-[2-(benzo[b][1]benzazepine-11-carbonylcarbamoyloxy)ethyldisulfanyl]ethyl N-[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]carbamate |
| SMILES | Nc1nc(NC(=O)OCCSSCCOC(=O)NC(=O)N2c3ccccc3C=Cc3ccccc32)nnc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C30H25Cl2N7O5S2/c31-21-9-5-8-20(24(21)32)25-26(33)34-27(38-37-25)35-29(41)43-14-16-45-46-17-15-44-30(42)36-28(40)39-22-10-3-1-6-18(22)12-13-19-7-2-4-11-23(19)39/h1-13H,14-17H2,(H,36,40,42)(H3,33,34,35,38,41) |
| InChIKey | MZPMMHOZXYLYLO-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 161.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.61 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|