C24H32N4O3 — CID 58608413
1-[(2R,6S)-4-[4-(6-amino-5-hydroxy-3-pyridinyl)benzoyl]-2,6-dimethylpiperazin-1-yl]hexan-1-one (PubChem CID 58608413) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is 1-[(2R,6S)-4-[4-(6-amino-5-hydroxy-3-pyridinyl)benzoyl]-2,6-dimethylpiperazin-1-yl]hexan-1-one.
| Compound Name | 1-[(2R,6S)-4-[4-(6-amino-5-hydroxy-3-pyridinyl)benzoyl]-2,6-dimethylpiperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 58608413 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 1-[(2R,6S)-4-[4-(6-amino-5-hydroxy-3-pyridinyl)benzoyl]-2,6-dimethylpiperazin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1[C@H](C)CN(C(=O)c2ccc(-c3cnc(N)c(O)c3)cc2)C[C@@H]1C |
| InChI | InChI=1S/C24H32N4O3/c1-4-5-6-7-22(30)28-16(2)14-27(15-17(28)3)24(31)19-10-8-18(9-11-19)20-12-21(29)23(25)26-13-20/h8-13,16-17,29H,4-7,14-15H2,1-3H3,(H2,25,26)/t16-,17+ |
| InChIKey | WAGPNLYOMAVUOH-CALCHBBNSA-N |
| XLogP | 3.68 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|