C25H24F3N3O5 — CID 58608532
tert-butyl N-[2-[4-[2-amino-3-(4-fluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenoxy]ethyl]carbamate (PubChem CID 58608532) has the molecular formula C25H24F3N3O5 and a molecular weight of 503.48 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[2-amino-3-(4-fluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[2-amino-3-(4-fluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 58608532 |
| Molecular Formula | C25H24F3N3O5 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | tert-butyl N-[2-[4-[2-amino-3-(4-fluorobenzoyl)-6-oxo-1-pyridinyl]-3,5-difluorophenoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1cc(F)c(-n2c(N)c(C(=O)c3ccc(F)cc3)ccc2=O)c(F)c1 |
| InChI | InChI=1S/C25H24F3N3O5/c1-25(2,3)36-24(34)30-10-11-35-16-12-18(27)21(19(28)13-16)31-20(32)9-8-17(23(31)29)22(33)14-4-6-15(26)7-5-14/h4-9,12-13H,10-11,29H2,1-3H3,(H,30,34) |
| InChIKey | KJDGJVSOJICYQJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|