About 3-(4-fluorophenyl)-3-oxo-N'-phenylpropanimidamide
3-(4-fluorophenyl)-3-oxo-N'-phenylpropanimidamide (PubChem CID 58608620) has the molecular formula C15H13FN2O
and a molecular weight of 256.28 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3-oxo-N'-phenylpropanimidamide.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-3-oxo-N'-phenylpropanimidamide |
| PubChem CID | 58608620 |
| Molecular Formula | C15H13FN2O |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 3-(4-fluorophenyl)-3-oxo-N'-phenylpropanimidamide |
| SMILES | N/C(CC(=O)c1ccc(F)cc1)=N\c1ccccc1 |
| InChI | InChI=1S/C15H13FN2O/c16-12-8-6-11(7-9-12)14(19)10-15(17)18-13-4-2-1-3-5-13/h1-9H,10H2,(H2,17,18) |
| InChIKey | GAHKZBRFPDQVEE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-fluorophenyl)-3-oxo-N'-phenylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-3-oxo-N'-phenylpropanimidamide?
The IUPAC name of 3-(4-fluorophenyl)-3-oxo-N'-phenylpropanimidamide (CID 58608620) is 3-(4-fluorophenyl)-3-oxo-N'-phenylpropanimidamide.
What is the SMILES notation for 3-(4-fluorophenyl)-3-oxo-N'-phenylpropanimidamide?
The canonical SMILES for 3-(4-fluorophenyl)-3-oxo-N'-phenylpropanimidamide is N/C(CC(=O)c1ccc(F)cc1)=N\c1ccccc1.
What is the InChIKey of 3-(4-fluorophenyl)-3-oxo-N'-phenylpropanimidamide?
The InChIKey is GAHKZBRFPDQVEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FN2O/c16-12-8-6-11(7-9-12)14(19)10-15(17)18-13-4-2-1-3-5-13/h1-9H,10H2,(H2,17,18).
What are the key properties of 3-(4-fluorophenyl)-3-oxo-N'-phenylpropanimidamide?
3-(4-fluorophenyl)-3-oxo-N'-phenylpropanimidamide has a molecular weight of 256.28 g/mol, XLogP of 3.09, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-3-oxo-N'-phenylpropanimidamide is sourced from PubChem (CID 58608620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).