About 3-(4-fluorophenyl)-N'-(3-methylphenyl)-3-oxopropanimidamide
3-(4-fluorophenyl)-N'-(3-methylphenyl)-3-oxopropanimidamide (PubChem CID 58608754) has the molecular formula C16H15FN2O
and a molecular weight of 270.31 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N'-(3-methylphenyl)-3-oxopropanimidamide.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-N'-(3-methylphenyl)-3-oxopropanimidamide |
| PubChem CID | 58608754 |
| Molecular Formula | C16H15FN2O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-(4-fluorophenyl)-N'-(3-methylphenyl)-3-oxopropanimidamide |
| SMILES | Cc1cccc(/N=C(\N)CC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C16H15FN2O/c1-11-3-2-4-14(9-11)19-16(18)10-15(20)12-5-7-13(17)8-6-12/h2-9H,10H2,1H3,(H2,18,19) |
| InChIKey | JDEWKGDGALLLJT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-fluorophenyl)-N'-(3-methylphenyl)-3-oxopropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-N'-(3-methylphenyl)-3-oxopropanimidamide?
The IUPAC name of 3-(4-fluorophenyl)-N'-(3-methylphenyl)-3-oxopropanimidamide (CID 58608754) is 3-(4-fluorophenyl)-N'-(3-methylphenyl)-3-oxopropanimidamide.
What is the SMILES notation for 3-(4-fluorophenyl)-N'-(3-methylphenyl)-3-oxopropanimidamide?
The canonical SMILES for 3-(4-fluorophenyl)-N'-(3-methylphenyl)-3-oxopropanimidamide is Cc1cccc(/N=C(\N)CC(=O)c2ccc(F)cc2)c1.
What is the InChIKey of 3-(4-fluorophenyl)-N'-(3-methylphenyl)-3-oxopropanimidamide?
The InChIKey is JDEWKGDGALLLJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FN2O/c1-11-3-2-4-14(9-11)19-16(18)10-15(20)12-5-7-13(17)8-6-12/h2-9H,10H2,1H3,(H2,18,19).
What are the key properties of 3-(4-fluorophenyl)-N'-(3-methylphenyl)-3-oxopropanimidamide?
3-(4-fluorophenyl)-N'-(3-methylphenyl)-3-oxopropanimidamide has a molecular weight of 270.31 g/mol, XLogP of 3.40, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-N'-(3-methylphenyl)-3-oxopropanimidamide is sourced from PubChem (CID 58608754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).