C20H26N2O4Si — CID 58608771
(2S)-2-carbazol-9-yl-N-(2-trimethoxysilylethyl)propanamide (PubChem CID 58608771) has the molecular formula C20H26N2O4Si and a molecular weight of 386.52 g/mol. Its IUPAC name is (2S)-2-carbazol-9-yl-N-(2-trimethoxysilylethyl)propanamide.
| Compound Name | (2S)-2-carbazol-9-yl-N-(2-trimethoxysilylethyl)propanamide |
|---|---|
| PubChem CID | 58608771 |
| Molecular Formula | C20H26N2O4Si |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (2S)-2-carbazol-9-yl-N-(2-trimethoxysilylethyl)propanamide |
| SMILES | CO[Si](CCNC(=O)[C@H](C)n1c2ccccc2c2ccccc21)(OC)OC |
| InChI | InChI=1S/C20H26N2O4Si/c1-15(20(23)21-13-14-27(24-2,25-3)26-4)22-18-11-7-5-9-16(18)17-10-6-8-12-19(17)22/h5-12,15H,13-14H2,1-4H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | VTMGXONBMBWEGZ-HNNXBMFYSA-N |
| XLogP | 3.35 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|