C33H46+2 — CID 58608809
1,4-ditert-butyl-2-[4-(2-tert-butyl-6-propan-2-ylphenyl)-2,3-dimethylbuta-1,3-dienyl]benzene (PubChem CID 58608809) has the molecular formula C33H46+2 and a molecular weight of 442.73 g/mol. Its IUPAC name is 1,4-ditert-butyl-2-[4-(2-tert-butyl-6-propan-2-ylphenyl)-2,3-dimethylbuta-1,3-dienyl]benzene.
| Compound Name | 1,4-ditert-butyl-2-[4-(2-tert-butyl-6-propan-2-ylphenyl)-2,3-dimethylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 58608809 |
| Molecular Formula | C33H46+2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.36 |
| IUPAC Name | 1,4-ditert-butyl-2-[4-(2-tert-butyl-6-propan-2-ylphenyl)-2,3-dimethylbuta-1,3-dienyl]benzene |
| SMILES | CC(=[C+]\c1cc(C(C)(C)C)ccc1C(C)(C)C)/C(C)=[C+]/c1c(C(C)C)cccc1C(C)(C)C |
| InChI | InChI=1S/C33H46/c1-22(2)27-15-14-16-30(33(11,12)13)28(27)20-24(4)23(3)19-25-21-26(31(5,6)7)17-18-29(25)32(8,9)10/h14-18,21-22H,1-13H3/q+2 |
| InChIKey | BGDPALIWRWCPKW-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|