About 3-fluoro-2,5-dimethylpiperidine
3-fluoro-2,5-dimethylpiperidine (PubChem CID 58609151) has the molecular formula C7H14FN
and a molecular weight of 131.19 g/mol. Its IUPAC name is 3-fluoro-2,5-dimethylpiperidine.
Molecular Properties
| Compound Name | 3-fluoro-2,5-dimethylpiperidine |
| PubChem CID | 58609151 |
| Molecular Formula | C7H14FN |
| Molecular Weight | 131.19 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | 3-fluoro-2,5-dimethylpiperidine |
| SMILES | CC1CNC(C)C(F)C1 |
| InChI | InChI=1S/C7H14FN/c1-5-3-7(8)6(2)9-4-5/h5-7,9H,3-4H2,1-2H3 |
| InChIKey | KUUBEOIPERTCDM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-2,5-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2,5-dimethylpiperidine?
The IUPAC name of 3-fluoro-2,5-dimethylpiperidine (CID 58609151) is 3-fluoro-2,5-dimethylpiperidine.
What is the SMILES notation for 3-fluoro-2,5-dimethylpiperidine?
The canonical SMILES for 3-fluoro-2,5-dimethylpiperidine is CC1CNC(C)C(F)C1.
What is the InChIKey of 3-fluoro-2,5-dimethylpiperidine?
The InChIKey is KUUBEOIPERTCDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14FN/c1-5-3-7(8)6(2)9-4-5/h5-7,9H,3-4H2,1-2H3.
What are the key properties of 3-fluoro-2,5-dimethylpiperidine?
3-fluoro-2,5-dimethylpiperidine has a molecular weight of 131.19 g/mol, XLogP of 1.34, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2,5-dimethylpiperidine is sourced from PubChem (CID 58609151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).