C59H104N2O6 — CID 58609245
5-[[3,4,5-tris(2-hexyldecoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 58609245) has the molecular formula C59H104N2O6 and a molecular weight of 937.49 g/mol. Its IUPAC name is 5-[[3,4,5-tris(2-hexyldecoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3,4,5-tris(2-hexyldecoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 58609245 |
| Molecular Formula | C59H104N2O6 |
| Molecular Weight | 937.49 g/mol |
| Exact Mass | 936.79 |
| IUPAC Name | 5-[[3,4,5-tris(2-hexyldecoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCCCCCC(CCCCCC)COc1cc(C=C2C(=O)NC(=O)NC2=O)cc(OCC(CCCCCC)CCCCCCCC)c1OCC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C59H104N2O6/c1-7-13-19-25-28-34-40-49(37-31-22-16-10-4)46-65-54-44-52(43-53-57(62)60-59(64)61-58(53)63)45-55(66-47-50(38-32-23-17-11-5)41-35-29-26-20-14-8-2)56(54)67-48-51(39-33-24-18-12-6)42-36-30-27-21-15-9-3/h43-45,49-51H,7-42,46-48H2,1-6H3,(H2,60,61,62,63,64) |
| InChIKey | RHFSNLHEJPTAAY-UHFFFAOYSA-N |
| XLogP | 17.58 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.49 |
| LogP ≤ 5 | 17.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|