C29H30N6O4 — CID 58609283
ethyl 4-[[4-(2-ethylanilino)-6-(4-propanoyloxyanilino)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 58609283) has the molecular formula C29H30N6O4 and a molecular weight of 526.60 g/mol. Its IUPAC name is ethyl 4-[[4-(2-ethylanilino)-6-(4-propanoyloxyanilino)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4-(2-ethylanilino)-6-(4-propanoyloxyanilino)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 58609283 |
| Molecular Formula | C29H30N6O4 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | ethyl 4-[[4-(2-ethylanilino)-6-(4-propanoyloxyanilino)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(Nc3ccc(OC(=O)CC)cc3)nc(Nc3ccccc3CC)n2)cc1 |
| InChI | InChI=1S/C29H30N6O4/c1-4-19-9-7-8-10-24(19)32-29-34-27(30-21-13-11-20(12-14-21)26(37)38-6-3)33-28(35-29)31-22-15-17-23(18-16-22)39-25(36)5-2/h7-18H,4-6H2,1-3H3,(H3,30,31,32,33,34,35) |
| InChIKey | WMJIODLWOITEMJ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|