C56H78B2N2O4 — CID 58609307
9-decyl-3-[9-decyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-3-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole (PubChem CID 58609307) has the molecular formula C56H78B2N2O4 and a molecular weight of 864.87 g/mol. Its IUPAC name is 9-decyl-3-[9-decyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-3-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole.
| Compound Name | 9-decyl-3-[9-decyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-3-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
|---|---|
| PubChem CID | 58609307 |
| Molecular Formula | C56H78B2N2O4 |
| Molecular Weight | 864.87 g/mol |
| Exact Mass | 864.61 |
| IUPAC Name | 9-decyl-3-[9-decyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-3-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
| SMILES | CCCCCCCCCCn1c2ccc(B3OC(C)(C)C(C)(C)O3)cc2c2cc(-c3ccc4c(c3)c3cc(B5OC(C)(C)C(C)(C)O5)ccc3n4CCCCCCCCCC)ccc21 |
| InChI | InChI=1S/C56H78B2N2O4/c1-11-13-15-17-19-21-23-25-35-59-49-31-27-41(37-45(49)47-39-43(29-33-51(47)59)57-61-53(3,4)54(5,6)62-57)42-28-32-50-46(38-42)48-40-44(58-63-55(7,8)56(9,10)64-58)30-34-52(48)60(50)36-26-24-22-20-18-16-14-12-2/h27-34,37-40H,11-26,35-36H2,1-10H3 |
| InChIKey | KSEVIPJLJFYFNS-UHFFFAOYSA-N |
| XLogP | 14.45 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.87 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|