About spiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]oct-6-ene]-2'-one
spiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]oct-6-ene]-2'-one (PubChem CID 58609533) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]oct-6-ene]-2'-one.
Molecular Properties
| Compound Name | spiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]oct-6-ene]-2'-one |
| PubChem CID | 58609533 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | spiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]oct-6-ene]-2'-one |
| SMILES | O=C1CC2(OCCO2)C2C=CC1C2 |
| InChI | InChI=1S/C10H12O3/c11-9-6-10(12-3-4-13-10)8-2-1-7(9)5-8/h1-2,7-8H,3-6H2 |
| InChIKey | QSIRYQCBLWBOMX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze spiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]oct-6-ene]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]oct-6-ene]-2'-one?
The IUPAC name of spiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]oct-6-ene]-2'-one (CID 58609533) is spiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]oct-6-ene]-2'-one.
What is the SMILES notation for spiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]oct-6-ene]-2'-one?
The canonical SMILES for spiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]oct-6-ene]-2'-one is O=C1CC2(OCCO2)C2C=CC1C2.
What is the InChIKey of spiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]oct-6-ene]-2'-one?
The InChIKey is QSIRYQCBLWBOMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c11-9-6-10(12-3-4-13-10)8-2-1-7(9)5-8/h1-2,7-8H,3-6H2.
What are the key properties of spiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]oct-6-ene]-2'-one?
spiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]oct-6-ene]-2'-one has a molecular weight of 180.20 g/mol, XLogP of 0.89, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]oct-6-ene]-2'-one is sourced from PubChem (CID 58609533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).