About 3,4-dihydro-2H-thiazine 1,1-dioxide
3,4-dihydro-2H-thiazine 1,1-dioxide (PubChem CID 58610118) has the molecular formula C4H7NO2S
and a molecular weight of 133.17 g/mol. Its IUPAC name is 3,4-dihydro-2H-thiazine 1,1-dioxide.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-thiazine 1,1-dioxide |
| PubChem CID | 58610118 |
| Molecular Formula | C4H7NO2S |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.02 |
| IUPAC Name | 3,4-dihydro-2H-thiazine 1,1-dioxide |
| SMILES | O=S1(=O)C=CCCN1 |
| InChI | InChI=1S/C4H7NO2S/c6-8(7)4-2-1-3-5-8/h2,4-5H,1,3H2 |
| InChIKey | AWNXEELHEWXRTR-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dihydro-2H-thiazine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-thiazine 1,1-dioxide?
The IUPAC name of 3,4-dihydro-2H-thiazine 1,1-dioxide (CID 58610118) is 3,4-dihydro-2H-thiazine 1,1-dioxide.
What is the SMILES notation for 3,4-dihydro-2H-thiazine 1,1-dioxide?
The canonical SMILES for 3,4-dihydro-2H-thiazine 1,1-dioxide is O=S1(=O)C=CCCN1.
What is the InChIKey of 3,4-dihydro-2H-thiazine 1,1-dioxide?
The InChIKey is AWNXEELHEWXRTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2S/c6-8(7)4-2-1-3-5-8/h2,4-5H,1,3H2.
What are the key properties of 3,4-dihydro-2H-thiazine 1,1-dioxide?
3,4-dihydro-2H-thiazine 1,1-dioxide has a molecular weight of 133.17 g/mol, XLogP of -0.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-thiazine 1,1-dioxide is sourced from PubChem (CID 58610118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).