C26H41NO6Si — CID 58610451
methyl (2R,3R,4R,5S)-6-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-4-[tert-butyl(dimethyl)silyl]oxy-2,3,5-trimethyl-6-oxohexanoate (PubChem CID 58610451) has the molecular formula C26H41NO6Si and a molecular weight of 491.70 g/mol. Its IUPAC name is methyl (2R,3R,4R,5S)-6-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-4-[tert-butyl(dimethyl)silyl]oxy-2,3,5-trimethyl-6-oxohexanoate.
| Compound Name | methyl (2R,3R,4R,5S)-6-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-4-[tert-butyl(dimethyl)silyl]oxy-2,3,5-trimethyl-6-oxohexanoate |
|---|---|
| PubChem CID | 58610451 |
| Molecular Formula | C26H41NO6Si |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | methyl (2R,3R,4R,5S)-6-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-4-[tert-butyl(dimethyl)silyl]oxy-2,3,5-trimethyl-6-oxohexanoate |
| SMILES | COC(=O)[C@H](C)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C26H41NO6Si/c1-17(18(2)24(29)31-7)22(33-34(8,9)26(4,5)6)19(3)23(28)27-21(16-32-25(27)30)15-20-13-11-10-12-14-20/h10-14,17-19,21-22H,15-16H2,1-9H3/t17-,18-,19+,21+,22-/m1/s1 |
| InChIKey | QEPXZHAEIOMDDL-PIBZIWMISA-N |
| XLogP | 5.05 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|