C12H17NO5 — CID 58610452
[(1S)-2-methyl-1-[(1R,4R,5S)-4-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-1-yl]propyl] acetate (PubChem CID 58610452) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is [(1S)-2-methyl-1-[(1R,4R,5S)-4-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-1-yl]propyl] acetate.
| Compound Name | [(1S)-2-methyl-1-[(1R,4R,5S)-4-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-1-yl]propyl] acetate |
|---|---|
| PubChem CID | 58610452 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | [(1S)-2-methyl-1-[(1R,4R,5S)-4-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-1-yl]propyl] acetate |
| SMILES | CC(=O)O[C@@H](C(C)C)[C@@]12NC(=O)[C@H](C)[C@@H]1OC2=O |
| InChI | InChI=1S/C12H17NO5/c1-5(2)8(17-7(4)14)12-9(18-11(12)16)6(3)10(15)13-12/h5-6,8-9H,1-4H3,(H,13,15)/t6-,8+,9+,12-/m1/s1 |
| InChIKey | HSTIIDPXFXCOMG-NNXMZFEESA-N |
| XLogP | 0.00 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|