C26H40O9 — CID 58610565
[(1R,5R,7R,8R,9R,10S,18R)-7,10-bis(ethylperoxy)-9,18-dihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-3-yl] acetate (PubChem CID 58610565) has the molecular formula C26H40O9 and a molecular weight of 496.60 g/mol. Its IUPAC name is [(1R,5R,7R,8R,9R,10S,18R)-7,10-bis(ethylperoxy)-9,18-dihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-3-yl] acetate.
| Compound Name | [(1R,5R,7R,8R,9R,10S,18R)-7,10-bis(ethylperoxy)-9,18-dihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-3-yl] acetate |
|---|---|
| PubChem CID | 58610565 |
| Molecular Formula | C26H40O9 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | [(1R,5R,7R,8R,9R,10S,18R)-7,10-bis(ethylperoxy)-9,18-dihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-3-yl] acetate |
| SMILES | C=C1[C@H]2CC(OC(C)=O)C3[C@]45CCCC(C)(C)C4[C@H](OOCC)[C@](O)(OC5)[C@@]3([C@@H]1OOCC)[C@@H]2O |
| InChI | InChI=1S/C26H40O9/c1-7-31-34-21-14(3)16-12-17(33-15(4)27)18-24-11-9-10-23(5,6)19(24)22(35-32-8-2)26(29,30-13-24)25(18,21)20(16)28/h16-22,28-29H,3,7-13H2,1-2,4-6H3/t16-,17?,18?,19?,20-,21-,22+,24-,25-,26+/m1/s1 |
| InChIKey | UHJRJAJZJXVQMS-PIEGPHBYSA-N |
| XLogP | 2.69 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|