C36H28N2S — CID 58610765
4,7-bis(9,9-dimethylfluoren-2-yl)-2,1,3-benzothiadiazole (PubChem CID 58610765) has the molecular formula C36H28N2S and a molecular weight of 520.70 g/mol. Its IUPAC name is 4,7-bis(9,9-dimethylfluoren-2-yl)-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis(9,9-dimethylfluoren-2-yl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 58610765 |
| Molecular Formula | C36H28N2S |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 4,7-bis(9,9-dimethylfluoren-2-yl)-2,1,3-benzothiadiazole |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4nsnc34)cc21 |
| InChI | InChI=1S/C36H28N2S/c1-35(2)29-11-7-5-9-25(29)27-15-13-21(19-31(27)35)23-17-18-24(34-33(23)37-39-38-34)22-14-16-28-26-10-6-8-12-30(26)36(3,4)32(28)20-22/h5-20H,1-4H3 |
| InChIKey | HFBAGLZSYJTYSV-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |