C28H20N2S3 — CID 58610797
4,7-bis[5-(2-methylphenyl)thiophen-2-yl]-2,1,3-benzothiadiazole (PubChem CID 58610797) has the molecular formula C28H20N2S3 and a molecular weight of 480.68 g/mol. Its IUPAC name is 4,7-bis[5-(2-methylphenyl)thiophen-2-yl]-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis[5-(2-methylphenyl)thiophen-2-yl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 58610797 |
| Molecular Formula | C28H20N2S3 |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 4,7-bis[5-(2-methylphenyl)thiophen-2-yl]-2,1,3-benzothiadiazole |
| SMILES | Cc1ccccc1-c1ccc(-c2ccc(-c3ccc(-c4ccccc4C)s3)c3nsnc23)s1 |
| InChI | InChI=1S/C28H20N2S3/c1-17-7-3-5-9-19(17)23-13-15-25(31-23)21-11-12-22(28-27(21)29-33-30-28)26-16-14-24(32-26)20-10-6-4-8-18(20)2/h3-16H,1-2H3 |
| InChIKey | PCRROXKNFVBOFX-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |