C44H46O14P2Si — CID 58610847
bis(2-acetyl-5-methoxyphenyl) [2-[bis(2-acetyl-5-methoxyphenoxy)phosphanyloxy-dimethylsilyl]phenyl] phosphite (PubChem CID 58610847) has the molecular formula C44H46O14P2Si and a molecular weight of 888.87 g/mol. Its IUPAC name is bis(2-acetyl-5-methoxyphenyl) [2-[bis(2-acetyl-5-methoxyphenoxy)phosphanyloxy-dimethylsilyl]phenyl] phosphite.
| Compound Name | bis(2-acetyl-5-methoxyphenyl) [2-[bis(2-acetyl-5-methoxyphenoxy)phosphanyloxy-dimethylsilyl]phenyl] phosphite |
|---|---|
| PubChem CID | 58610847 |
| Molecular Formula | C44H46O14P2Si |
| Molecular Weight | 888.87 g/mol |
| Exact Mass | 888.21 |
| IUPAC Name | bis(2-acetyl-5-methoxyphenyl) [2-[bis(2-acetyl-5-methoxyphenoxy)phosphanyloxy-dimethylsilyl]phenyl] phosphite |
| SMILES | COc1ccc(C(C)=O)c(OP(Oc2cc(OC)ccc2C(C)=O)Oc2ccccc2[Si](C)(C)OP(Oc2cc(OC)ccc2C(C)=O)Oc2cc(OC)ccc2C(C)=O)c1 |
| InChI | InChI=1S/C44H46O14P2Si/c1-27(45)35-19-15-31(49-5)23-40(35)54-59(55-41-24-32(50-6)16-20-36(41)28(2)46)53-39-13-11-12-14-44(39)61(9,10)58-60(56-42-25-33(51-7)17-21-37(42)29(3)47)57-43-26-34(52-8)18-22-38(43)30(4)48/h11-26H,1-10H3 |
| InChIKey | QRZQICNGSWIKHV-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 160.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.87 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|