About [2-(dipyridin-2-yloxyphosphanyloxymethyl)phenyl] dipyridin-2-yl phosphite
[2-(dipyridin-2-yloxyphosphanyloxymethyl)phenyl] dipyridin-2-yl phosphite (PubChem CID 58610931) has the molecular formula C27H22N4O6P2
and a molecular weight of 560.44 g/mol. Its IUPAC name is [2-(dipyridin-2-yloxyphosphanyloxymethyl)phenyl] dipyridin-2-yl phosphite.
Molecular Properties
| Compound Name | [2-(dipyridin-2-yloxyphosphanyloxymethyl)phenyl] dipyridin-2-yl phosphite |
| PubChem CID | 58610931 |
| Molecular Formula | C27H22N4O6P2 |
| Molecular Weight | 560.44 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | [2-(dipyridin-2-yloxyphosphanyloxymethyl)phenyl] dipyridin-2-yl phosphite |
| SMILES | c1ccc(OP(OCc2ccccc2OP(Oc2ccccn2)Oc2ccccn2)Oc2ccccn2)nc1 |
| InChI | InChI=1S/C27H22N4O6P2/c1-2-12-23(33-39(36-26-15-5-9-19-30-26)37-27-16-6-10-20-31-27)22(11-1)21-32-38(34-24-13-3-7-17-28-24)35-25-14-4-8-18-29-25/h1-20H,21H2 |
| InChIKey | KHDDHTHZQOQTRY-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 106.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 560.44 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-(dipyridin-2-yloxyphosphanyloxymethyl)phenyl] dipyridin-2-yl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(dipyridin-2-yloxyphosphanyloxymethyl)phenyl] dipyridin-2-yl phosphite?
The IUPAC name of [2-(dipyridin-2-yloxyphosphanyloxymethyl)phenyl] dipyridin-2-yl phosphite (CID 58610931) is [2-(dipyridin-2-yloxyphosphanyloxymethyl)phenyl] dipyridin-2-yl phosphite.
What is the SMILES notation for [2-(dipyridin-2-yloxyphosphanyloxymethyl)phenyl] dipyridin-2-yl phosphite?
The canonical SMILES for [2-(dipyridin-2-yloxyphosphanyloxymethyl)phenyl] dipyridin-2-yl phosphite is c1ccc(OP(OCc2ccccc2OP(Oc2ccccn2)Oc2ccccn2)Oc2ccccn2)nc1.
What is the InChIKey of [2-(dipyridin-2-yloxyphosphanyloxymethyl)phenyl] dipyridin-2-yl phosphite?
The InChIKey is KHDDHTHZQOQTRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22N4O6P2/c1-2-12-23(33-39(36-26-15-5-9-19-30-26)37-27-16-6-10-20-31-27)22(11-1)21-32-38(34-24-13-3-7-17-28-24)35-25-14-4-8-18-29-25/h1-20H,21H2.
What are the key properties of [2-(dipyridin-2-yloxyphosphanyloxymethyl)phenyl] dipyridin-2-yl phosphite?
[2-(dipyridin-2-yloxyphosphanyloxymethyl)phenyl] dipyridin-2-yl phosphite has a molecular weight of 560.44 g/mol, XLogP of 6.93, 13 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(dipyridin-2-yloxyphosphanyloxymethyl)phenyl] dipyridin-2-yl phosphite is sourced from PubChem (CID 58610931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).