About [2-[bis(2-formylphenoxy)phosphanyloxymethyl]phenyl] bis(2-formylphenyl) phosphite
[2-[bis(2-formylphenoxy)phosphanyloxymethyl]phenyl] bis(2-formylphenyl) phosphite (PubChem CID 58611063) has the molecular formula C35H26O10P2
and a molecular weight of 668.53 g/mol. Its IUPAC name is [2-[bis(2-formylphenoxy)phosphanyloxymethyl]phenyl] bis(2-formylphenyl) phosphite.
Molecular Properties
| Compound Name | [2-[bis(2-formylphenoxy)phosphanyloxymethyl]phenyl] bis(2-formylphenyl) phosphite |
| PubChem CID | 58611063 |
| Molecular Formula | C35H26O10P2 |
| Molecular Weight | 668.53 g/mol |
| Exact Mass | 668.10 |
| IUPAC Name | [2-[bis(2-formylphenoxy)phosphanyloxymethyl]phenyl] bis(2-formylphenyl) phosphite |
| SMILES | O=Cc1ccccc1OP(OCc1ccccc1OP(Oc1ccccc1C=O)Oc1ccccc1C=O)Oc1ccccc1C=O |
| InChI | InChI=1S/C35H26O10P2/c36-21-26-11-1-6-16-31(26)41-46(42-32-17-7-2-12-27(32)22-37)40-25-30-15-5-10-20-35(30)45-47(43-33-18-8-3-13-28(33)23-38)44-34-19-9-4-14-29(34)24-39/h1-24H,25H2 |
| InChIKey | VRQJHRVXMILPGT-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 668.53 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-[bis(2-formylphenoxy)phosphanyloxymethyl]phenyl] bis(2-formylphenyl) phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[bis(2-formylphenoxy)phosphanyloxymethyl]phenyl] bis(2-formylphenyl) phosphite?
The IUPAC name of [2-[bis(2-formylphenoxy)phosphanyloxymethyl]phenyl] bis(2-formylphenyl) phosphite (CID 58611063) is [2-[bis(2-formylphenoxy)phosphanyloxymethyl]phenyl] bis(2-formylphenyl) phosphite.
What is the SMILES notation for [2-[bis(2-formylphenoxy)phosphanyloxymethyl]phenyl] bis(2-formylphenyl) phosphite?
The canonical SMILES for [2-[bis(2-formylphenoxy)phosphanyloxymethyl]phenyl] bis(2-formylphenyl) phosphite is O=Cc1ccccc1OP(OCc1ccccc1OP(Oc1ccccc1C=O)Oc1ccccc1C=O)Oc1ccccc1C=O.
What is the InChIKey of [2-[bis(2-formylphenoxy)phosphanyloxymethyl]phenyl] bis(2-formylphenyl) phosphite?
The InChIKey is VRQJHRVXMILPGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H26O10P2/c36-21-26-11-1-6-16-31(26)41-46(42-32-17-7-2-12-27(32)22-37)40-25-30-15-5-10-20-35(30)45-47(43-33-18-8-3-13-28(33)23-38)44-34-19-9-4-14-29(34)24-39/h1-24H,25H2.
What are the key properties of [2-[bis(2-formylphenoxy)phosphanyloxymethyl]phenyl] bis(2-formylphenyl) phosphite?
[2-[bis(2-formylphenoxy)phosphanyloxymethyl]phenyl] bis(2-formylphenyl) phosphite has a molecular weight of 668.53 g/mol, XLogP of 8.60, 17 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[bis(2-formylphenoxy)phosphanyloxymethyl]phenyl] bis(2-formylphenyl) phosphite is sourced from PubChem (CID 58611063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).