About 5-N,5-N-dimethylpyrazolo[1,5-a]pyrimidine-3,5-diamine
5-N,5-N-dimethylpyrazolo[1,5-a]pyrimidine-3,5-diamine (PubChem CID 58611206) has the molecular formula C8H11N5
and a molecular weight of 177.21 g/mol. Its IUPAC name is 5-N,5-N-dimethylpyrazolo[1,5-a]pyrimidine-3,5-diamine.
Molecular Properties
| Compound Name | 5-N,5-N-dimethylpyrazolo[1,5-a]pyrimidine-3,5-diamine |
| PubChem CID | 58611206 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 5-N,5-N-dimethylpyrazolo[1,5-a]pyrimidine-3,5-diamine |
| SMILES | CN(C)c1ccn2ncc(N)c2n1 |
| InChI | InChI=1S/C8H11N5/c1-12(2)7-3-4-13-8(11-7)6(9)5-10-13/h3-5H,9H2,1-2H3 |
| InChIKey | UDJSYOYGRVYMIC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-N,5-N-dimethylpyrazolo[1,5-a]pyrimidine-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N,5-N-dimethylpyrazolo[1,5-a]pyrimidine-3,5-diamine?
The IUPAC name of 5-N,5-N-dimethylpyrazolo[1,5-a]pyrimidine-3,5-diamine (CID 58611206) is 5-N,5-N-dimethylpyrazolo[1,5-a]pyrimidine-3,5-diamine.
What is the SMILES notation for 5-N,5-N-dimethylpyrazolo[1,5-a]pyrimidine-3,5-diamine?
The canonical SMILES for 5-N,5-N-dimethylpyrazolo[1,5-a]pyrimidine-3,5-diamine is CN(C)c1ccn2ncc(N)c2n1.
What is the InChIKey of 5-N,5-N-dimethylpyrazolo[1,5-a]pyrimidine-3,5-diamine?
The InChIKey is UDJSYOYGRVYMIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5/c1-12(2)7-3-4-13-8(11-7)6(9)5-10-13/h3-5H,9H2,1-2H3.
What are the key properties of 5-N,5-N-dimethylpyrazolo[1,5-a]pyrimidine-3,5-diamine?
5-N,5-N-dimethylpyrazolo[1,5-a]pyrimidine-3,5-diamine has a molecular weight of 177.21 g/mol, XLogP of 0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N,5-N-dimethylpyrazolo[1,5-a]pyrimidine-3,5-diamine is sourced from PubChem (CID 58611206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).