C17H20N4O4 — CID 58611252
N,N'-bis(3-methyl-4-nitrophenyl)propane-1,3-diamine (PubChem CID 58611252) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is N,N'-bis(3-methyl-4-nitrophenyl)propane-1,3-diamine.
| Compound Name | N,N'-bis(3-methyl-4-nitrophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 58611252 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N,N'-bis(3-methyl-4-nitrophenyl)propane-1,3-diamine |
| SMILES | Cc1cc(NCCCNc2ccc([N+](=O)[O-])c(C)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20N4O4/c1-12-10-14(4-6-16(12)20(22)23)18-8-3-9-19-15-5-7-17(21(24)25)13(2)11-15/h4-7,10-11,18-19H,3,8-9H2,1-2H3 |
| InChIKey | MJBNVAAWTZIMSC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|