C21H30N4O4 — CID 58611254
4-N-hydroperoxy-2-methyl-1-N-[7-(2-methyl-4-nitroanilino)heptyl]benzene-1,4-diamine (PubChem CID 58611254) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is 4-N-hydroperoxy-2-methyl-1-N-[7-(2-methyl-4-nitroanilino)heptyl]benzene-1,4-diamine.
| Compound Name | 4-N-hydroperoxy-2-methyl-1-N-[7-(2-methyl-4-nitroanilino)heptyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 58611254 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 4-N-hydroperoxy-2-methyl-1-N-[7-(2-methyl-4-nitroanilino)heptyl]benzene-1,4-diamine |
| SMILES | Cc1cc(NOO)ccc1NCCCCCCCNc1ccc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C21H30N4O4/c1-16-14-18(24-29-28)8-10-20(16)22-12-6-4-3-5-7-13-23-21-11-9-19(25(26)27)15-17(21)2/h8-11,14-15,22-24,28H,3-7,12-13H2,1-2H3 |
| InChIKey | FMQOEWVZABVQTI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|