C28H41NO — CID 58611344
2,6-ditert-butyl-4-[2-(1-hexyl-2-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-dien-1-one (PubChem CID 58611344) has the molecular formula C28H41NO and a molecular weight of 407.64 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2-(1-hexyl-2-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-[2-(1-hexyl-2-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 58611344 |
| Molecular Formula | C28H41NO |
| Molecular Weight | 407.64 g/mol |
| Exact Mass | 407.32 |
| IUPAC Name | 2,6-ditert-butyl-4-[2-(1-hexyl-2-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-dien-1-one |
| SMILES | CCCCCCN1C=CC(=CC=C2C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)C=C1C |
| InChI | InChI=1S/C28H41NO/c1-9-10-11-12-16-29-17-15-22(18-21(29)2)13-14-23-19-24(27(3,4)5)26(30)25(20-23)28(6,7)8/h13-15,17-20H,9-12,16H2,1-8H3 |
| InChIKey | TXWHLUMPCLCGGR-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.64 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|