About N,5-dimethyl-N-(propan-2-ylideneamino)hexa-2,4-dien-1-amine
N,5-dimethyl-N-(propan-2-ylideneamino)hexa-2,4-dien-1-amine (PubChem CID 58611576) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is N,5-dimethyl-N-(propan-2-ylideneamino)hexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | N,5-dimethyl-N-(propan-2-ylideneamino)hexa-2,4-dien-1-amine |
| PubChem CID | 58611576 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N,5-dimethyl-N-(propan-2-ylideneamino)hexa-2,4-dien-1-amine |
| SMILES | CC(C)=CC=CCN(C)N=C(C)C |
| InChI | InChI=1S/C11H20N2/c1-10(2)8-6-7-9-13(5)12-11(3)4/h6-8H,9H2,1-5H3 |
| InChIKey | AKBGZTYOUIIZLC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N,5-dimethyl-N-(propan-2-ylideneamino)hexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-dimethyl-N-(propan-2-ylideneamino)hexa-2,4-dien-1-amine?
The IUPAC name of N,5-dimethyl-N-(propan-2-ylideneamino)hexa-2,4-dien-1-amine (CID 58611576) is N,5-dimethyl-N-(propan-2-ylideneamino)hexa-2,4-dien-1-amine.
What is the SMILES notation for N,5-dimethyl-N-(propan-2-ylideneamino)hexa-2,4-dien-1-amine?
The canonical SMILES for N,5-dimethyl-N-(propan-2-ylideneamino)hexa-2,4-dien-1-amine is CC(C)=CC=CCN(C)N=C(C)C.
What is the InChIKey of N,5-dimethyl-N-(propan-2-ylideneamino)hexa-2,4-dien-1-amine?
The InChIKey is AKBGZTYOUIIZLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-10(2)8-6-7-9-13(5)12-11(3)4/h6-8H,9H2,1-5H3.
What are the key properties of N,5-dimethyl-N-(propan-2-ylideneamino)hexa-2,4-dien-1-amine?
N,5-dimethyl-N-(propan-2-ylideneamino)hexa-2,4-dien-1-amine has a molecular weight of 180.29 g/mol, XLogP of 2.84, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-dimethyl-N-(propan-2-ylideneamino)hexa-2,4-dien-1-amine is sourced from PubChem (CID 58611576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).