About lithium methylsulfanyl 3-sulfenatopropanoate
lithium methylsulfanyl 3-sulfenatopropanoate (PubChem CID 58611701) has the molecular formula C4H7LiO3S2
and a molecular weight of 174.17 g/mol. Its IUPAC name is lithium methylsulfanyl 3-sulfenatopropanoate.
Molecular Properties
| Compound Name | lithium methylsulfanyl 3-sulfenatopropanoate |
| PubChem CID | 58611701 |
| Molecular Formula | C4H7LiO3S2 |
| Molecular Weight | 174.17 g/mol |
| Exact Mass | 174.00 |
| IUPAC Name | lithium methylsulfanyl 3-sulfenatopropanoate |
| SMILES | CSOC(=O)CCS[O-].[Li+] |
| InChI | InChI=1S/C4H8O3S2.Li/c1-8-7-4(5)2-3-9-6;/h6H,2-3H2,1H3;/q;+1/p-1 |
| InChIKey | KNSHVVOTTWEHAR-UHFFFAOYSA-M |
| XLogP | -1.93 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.17 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze lithium methylsulfanyl 3-sulfenatopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium methylsulfanyl 3-sulfenatopropanoate?
The IUPAC name of lithium methylsulfanyl 3-sulfenatopropanoate (CID 58611701) is lithium methylsulfanyl 3-sulfenatopropanoate.
What is the SMILES notation for lithium methylsulfanyl 3-sulfenatopropanoate?
The canonical SMILES for lithium methylsulfanyl 3-sulfenatopropanoate is CSOC(=O)CCS[O-].[Li+].
What is the InChIKey of lithium methylsulfanyl 3-sulfenatopropanoate?
The InChIKey is KNSHVVOTTWEHAR-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H8O3S2.Li/c1-8-7-4(5)2-3-9-6;/h6H,2-3H2,1H3;/q;+1/p-1.
What are the key properties of lithium methylsulfanyl 3-sulfenatopropanoate?
lithium methylsulfanyl 3-sulfenatopropanoate has a molecular weight of 174.17 g/mol, XLogP of -1.93, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium methylsulfanyl 3-sulfenatopropanoate is sourced from PubChem (CID 58611701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).