About CID 58611714
CID 58611714 (PubChem CID 58611714) has the molecular formula C11H19N2O2S
and a molecular weight of 243.35 g/mol.
Molecular Properties
| Compound Name | CID 58611714 |
| PubChem CID | 58611714 |
| Molecular Formula | C11H19N2O2S |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | — |
| SMILES | CCSCC(C[CH]C(N)=O)N1CCCC1=O |
| InChI | InChI=1S/C11H19N2O2S/c1-2-16-8-9(5-6-10(12)14)13-7-3-4-11(13)15/h6,9H,2-5,7-8H2,1H3,(H2,12,14) |
| InChIKey | LCSZBSKDQGKMMM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 58611714 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58611714?
The IUPAC name of CID 58611714 (CID 58611714) is not available.
What is the SMILES notation for CID 58611714?
The canonical SMILES for CID 58611714 is CCSCC(C[CH]C(N)=O)N1CCCC1=O.
What is the InChIKey of CID 58611714?
The InChIKey is LCSZBSKDQGKMMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N2O2S/c1-2-16-8-9(5-6-10(12)14)13-7-3-4-11(13)15/h6,9H,2-5,7-8H2,1H3,(H2,12,14).
What are the key properties of CID 58611714?
CID 58611714 has a molecular weight of 243.35 g/mol, XLogP of 0.81, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58611714 is sourced from PubChem (CID 58611714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).