C26H35NO5 — CID 58611814
[(3S,5R)-1-[6-(1,3-dioxoinden-2-yl)hexyl]-5-ethylpyrrolidin-3-yl] 4-oxopentanoate (PubChem CID 58611814) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is [(3S,5R)-1-[6-(1,3-dioxoinden-2-yl)hexyl]-5-ethylpyrrolidin-3-yl] 4-oxopentanoate.
| Compound Name | [(3S,5R)-1-[6-(1,3-dioxoinden-2-yl)hexyl]-5-ethylpyrrolidin-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 58611814 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | [(3S,5R)-1-[6-(1,3-dioxoinden-2-yl)hexyl]-5-ethylpyrrolidin-3-yl] 4-oxopentanoate |
| SMILES | CC[C@@H]1C[C@H](OC(=O)CCC(C)=O)CN1CCCCCCC1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H35NO5/c1-3-19-16-20(32-24(29)14-13-18(2)28)17-27(19)15-9-5-4-6-12-23-25(30)21-10-7-8-11-22(21)26(23)31/h7-8,10-11,19-20,23H,3-6,9,12-17H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | WDJCMPVTXXRIOI-UXHICEINSA-N |
| XLogP | 4.40 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|