About [3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] 4-oxopentanoate
[3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] 4-oxopentanoate (PubChem CID 58611821) has the molecular formula C17H24O4
and a molecular weight of 292.38 g/mol. Its IUPAC name is [3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] 4-oxopentanoate.
Molecular Properties
| Compound Name | [3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] 4-oxopentanoate |
| PubChem CID | 58611821 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] 4-oxopentanoate |
| SMILES | C/C=C/C1=C(C)C(=O)C(OC(=O)CCC(C)=O)CC1(C)C |
| InChI | InChI=1S/C17H24O4/c1-6-7-13-12(3)16(20)14(10-17(13,4)5)21-15(19)9-8-11(2)18/h6-7,14H,8-10H2,1-5H3/b7-6+ |
| InChIKey | BPHOCCCWONXVOB-VOTSOKGWSA-N |
| XLogP | 3.16 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] 4-oxopentanoate?
The IUPAC name of [3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] 4-oxopentanoate (CID 58611821) is [3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] 4-oxopentanoate.
What is the SMILES notation for [3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] 4-oxopentanoate?
The canonical SMILES for [3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] 4-oxopentanoate is C/C=C/C1=C(C)C(=O)C(OC(=O)CCC(C)=O)CC1(C)C.
What is the InChIKey of [3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] 4-oxopentanoate?
The InChIKey is BPHOCCCWONXVOB-VOTSOKGWSA-N. The full InChI is InChI=1S/C17H24O4/c1-6-7-13-12(3)16(20)14(10-17(13,4)5)21-15(19)9-8-11(2)18/h6-7,14H,8-10H2,1-5H3/b7-6+.
What are the key properties of [3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] 4-oxopentanoate?
[3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] 4-oxopentanoate has a molecular weight of 292.38 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] 4-oxopentanoate is sourced from PubChem (CID 58611821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).