About 1-ethyl-4-methyltriazole
1-ethyl-4-methyltriazole (PubChem CID 58612101) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is 1-ethyl-4-methyltriazole.
Molecular Properties
| Compound Name | 1-ethyl-4-methyltriazole |
| PubChem CID | 58612101 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 1-ethyl-4-methyltriazole |
| SMILES | CCn1cc(C)nn1 |
| InChI | InChI=1S/C5H9N3/c1-3-8-4-5(2)6-7-8/h4H,3H2,1-2H3 |
| InChIKey | MJIOJWXRXDWUBV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-4-methyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-methyltriazole?
The IUPAC name of 1-ethyl-4-methyltriazole (CID 58612101) is 1-ethyl-4-methyltriazole.
What is the SMILES notation for 1-ethyl-4-methyltriazole?
The canonical SMILES for 1-ethyl-4-methyltriazole is CCn1cc(C)nn1.
What is the InChIKey of 1-ethyl-4-methyltriazole?
The InChIKey is MJIOJWXRXDWUBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3/c1-3-8-4-5(2)6-7-8/h4H,3H2,1-2H3.
What are the key properties of 1-ethyl-4-methyltriazole?
1-ethyl-4-methyltriazole has a molecular weight of 111.15 g/mol, XLogP of 0.61, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-methyltriazole is sourced from PubChem (CID 58612101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).