C25H25N5O — CID 58612156
4-[[4-[4-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-2-pyridinyl]phenyl]methyl]morpholine (PubChem CID 58612156) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is 4-[[4-[4-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-2-pyridinyl]phenyl]methyl]morpholine.
| Compound Name | 4-[[4-[4-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-2-pyridinyl]phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 58612156 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 4-[[4-[4-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-2-pyridinyl]phenyl]methyl]morpholine |
| SMILES | Cc1cccc(-c2[nH]ncc2-c2ccnc(-c3ccc(CN4CCOCC4)cc3)c2)n1 |
| InChI | InChI=1S/C25H25N5O/c1-18-3-2-4-23(28-18)25-22(16-27-29-25)21-9-10-26-24(15-21)20-7-5-19(6-8-20)17-30-11-13-31-14-12-30/h2-10,15-16H,11-14,17H2,1H3,(H,27,29) |
| InChIKey | VJJXFFACAZAFOV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |