About 7-(2-chloro-5-methoxyanilino)-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile
7-(2-chloro-5-methoxyanilino)-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile (PubChem CID 58612183) has the molecular formula C15H11ClN4OS2
and a molecular weight of 362.87 g/mol. Its IUPAC name is 7-(2-chloro-5-methoxyanilino)-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile.
Molecular Properties
| Compound Name | 7-(2-chloro-5-methoxyanilino)-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile |
| PubChem CID | 58612183 |
| Molecular Formula | C15H11ClN4OS2 |
| Molecular Weight | 362.87 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 7-(2-chloro-5-methoxyanilino)-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile |
| SMILES | COc1ccc(Cl)c(Nc2c(C#N)cnc3nc(SC)sc23)c1 |
| InChI | InChI=1S/C15H11ClN4OS2/c1-21-9-3-4-10(16)11(5-9)19-12-8(6-17)7-18-14-13(12)23-15(20-14)22-2/h3-5,7H,1-2H3,(H,18,19) |
| InChIKey | QOTAJAYBPWEMDL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.87 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-(2-chloro-5-methoxyanilino)-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-chloro-5-methoxyanilino)-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile?
The IUPAC name of 7-(2-chloro-5-methoxyanilino)-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile (CID 58612183) is 7-(2-chloro-5-methoxyanilino)-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile.
What is the SMILES notation for 7-(2-chloro-5-methoxyanilino)-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile?
The canonical SMILES for 7-(2-chloro-5-methoxyanilino)-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile is COc1ccc(Cl)c(Nc2c(C#N)cnc3nc(SC)sc23)c1.
What is the InChIKey of 7-(2-chloro-5-methoxyanilino)-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile?
The InChIKey is QOTAJAYBPWEMDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClN4OS2/c1-21-9-3-4-10(16)11(5-9)19-12-8(6-17)7-18-14-13(12)23-15(20-14)22-2/h3-5,7H,1-2H3,(H,18,19).
What are the key properties of 7-(2-chloro-5-methoxyanilino)-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile?
7-(2-chloro-5-methoxyanilino)-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile has a molecular weight of 362.87 g/mol, XLogP of 4.69, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-chloro-5-methoxyanilino)-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile is sourced from PubChem (CID 58612183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).